C21H16O4 — CID 747847
2-(3,4-dimethoxyphenyl)benzo[f]chromen-3-one (PubChem CID 747847) has the molecular formula C21H16O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)benzo[f]chromen-3-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)benzo[f]chromen-3-one |
|---|---|
| PubChem CID | 747847 |
| Molecular Formula | C21H16O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)benzo[f]chromen-3-one |
| SMILES | COc1ccc(-c2cc3c(ccc4ccccc43)oc2=O)cc1OC |
| InChI | InChI=1S/C21H16O4/c1-23-19-10-8-14(11-20(19)24-2)16-12-17-15-6-4-3-5-13(15)7-9-18(17)25-21(16)22/h3-12H,1-2H3 |
| InChIKey | RTHLUXXSEISSOY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|