C22H18O5 — CID 73346146
3-(3,4-dimethoxyphenyl)-2-methoxybenzo[f]chromen-1-one (PubChem CID 73346146) has the molecular formula C22H18O5 and a molecular weight of 362.38 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-methoxybenzo[f]chromen-1-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-methoxybenzo[f]chromen-1-one |
|---|---|
| PubChem CID | 73346146 |
| Molecular Formula | C22H18O5 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-methoxybenzo[f]chromen-1-one |
| SMILES | COc1ccc(-c2oc3ccc4ccccc4c3c(=O)c2OC)cc1OC |
| InChI | InChI=1S/C22H18O5/c1-24-16-10-9-14(12-18(16)25-2)21-22(26-3)20(23)19-15-7-5-4-6-13(15)8-11-17(19)27-21/h4-12H,1-3H3 |
| InChIKey | KVQSMEDXRLSCNZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|