C27H26O7 — CID 59838501
2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3-(2-phenylethoxy)chromen-4-one (PubChem CID 59838501) has the molecular formula C27H26O7 and a molecular weight of 462.50 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3-(2-phenylethoxy)chromen-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3-(2-phenylethoxy)chromen-4-one |
|---|---|
| PubChem CID | 59838501 |
| Molecular Formula | C27H26O7 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-3-(2-phenylethoxy)chromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(OCCc3ccccc3)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C27H26O7/c1-29-19-15-22(32-4)24-23(16-19)34-26(18-10-11-20(30-2)21(14-18)31-3)27(25(24)28)33-13-12-17-8-6-5-7-9-17/h5-11,14-16H,12-13H2,1-4H3 |
| InChIKey | ZLVNJRJSDMXMGT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 76.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |