C31H32O8 — CID 68892528
3-[3-(4-acetylphenoxy)propoxy]-2-(3,4-dimethoxyphenyl)-7-ethyl-5-methoxychromen-4-one (PubChem CID 68892528) has the molecular formula C31H32O8 and a molecular weight of 532.59 g/mol. Its IUPAC name is 3-[3-(4-acetylphenoxy)propoxy]-2-(3,4-dimethoxyphenyl)-7-ethyl-5-methoxychromen-4-one.
| Compound Name | 3-[3-(4-acetylphenoxy)propoxy]-2-(3,4-dimethoxyphenyl)-7-ethyl-5-methoxychromen-4-one |
|---|---|
| PubChem CID | 68892528 |
| Molecular Formula | C31H32O8 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | 3-[3-(4-acetylphenoxy)propoxy]-2-(3,4-dimethoxyphenyl)-7-ethyl-5-methoxychromen-4-one |
| SMILES | CCc1cc(OC)c2c(=O)c(OCCCOc3ccc(C(C)=O)cc3)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C31H32O8/c1-6-20-16-26(36-5)28-27(17-20)39-30(22-10-13-24(34-3)25(18-22)35-4)31(29(28)33)38-15-7-14-37-23-11-8-21(9-12-23)19(2)32/h8-13,16-18H,6-7,14-15H2,1-5H3 |
| InChIKey | SMFNUMCWMCDBTG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|