C29H28O9 — CID 15965500
3-[2-(4-acetylphenoxy)ethoxy]-2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one (PubChem CID 15965500) has the molecular formula C29H28O9 and a molecular weight of 520.53 g/mol. Its IUPAC name is 3-[2-(4-acetylphenoxy)ethoxy]-2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one.
| Compound Name | 3-[2-(4-acetylphenoxy)ethoxy]-2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 15965500 |
| Molecular Formula | C29H28O9 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 3-[2-(4-acetylphenoxy)ethoxy]-2-(3,4-dimethoxyphenyl)-5,7-dimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(OCCOc3ccc(C(C)=O)cc3)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C29H28O9/c1-17(30)18-6-9-20(10-7-18)36-12-13-37-29-27(31)26-24(35-5)15-21(32-2)16-25(26)38-28(29)19-8-11-22(33-3)23(14-19)34-4/h6-11,14-16H,12-13H2,1-5H3 |
| InChIKey | XGVOUCKVINKIDL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 102.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|