C22H24O8 — CID 101179168
2-(3,4-dimethoxyphenyl)-3-(3-hydroxypropoxy)-5,7-dimethoxychromen-4-one (PubChem CID 101179168) has the molecular formula C22H24O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-(3-hydroxypropoxy)-5,7-dimethoxychromen-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-(3-hydroxypropoxy)-5,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 101179168 |
| Molecular Formula | C22H24O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-(3-hydroxypropoxy)-5,7-dimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCO)c(-c3ccc(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C22H24O8/c1-25-14-11-17(28-4)19-18(12-14)30-21(22(20(19)24)29-9-5-8-23)13-6-7-15(26-2)16(10-13)27-3/h6-7,10-12,23H,5,8-9H2,1-4H3 |
| InChIKey | JUKKPQNPRZRPJZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|