C36H35FN2O8 — CID 175086256
3-[3-[2-(3-fluorophenyl)-1,3-dihydrobenzimidazol-2-yl]propoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 175086256) has the molecular formula C36H35FN2O8 and a molecular weight of 642.68 g/mol. Its IUPAC name is 3-[3-[2-(3-fluorophenyl)-1,3-dihydrobenzimidazol-2-yl]propoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 3-[3-[2-(3-fluorophenyl)-1,3-dihydrobenzimidazol-2-yl]propoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 175086256 |
| Molecular Formula | C36H35FN2O8 |
| Molecular Weight | 642.68 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | 3-[3-[2-(3-fluorophenyl)-1,3-dihydrobenzimidazol-2-yl]propoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCC3(c4cccc(F)c4)Nc4ccccc4N3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C36H35FN2O8/c1-41-24-19-27(42-2)31-28(20-24)47-33(21-16-29(43-3)34(45-5)30(17-21)44-4)35(32(31)40)46-15-9-14-36(22-10-8-11-23(37)18-22)38-25-12-6-7-13-26(25)39-36/h6-8,10-13,16-20,38-39H,9,14-15H2,1-5H3 |
| InChIKey | ZTWQDWBSVZERGZ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.68 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|