C40H39NO9S — CID 167313415
5,7-dimethoxy-3-[4-[2-(3-methoxyphenyl)quinolin-4-yl]sulfanylbutoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 167313415) has the molecular formula C40H39NO9S and a molecular weight of 709.82 g/mol. Its IUPAC name is 5,7-dimethoxy-3-[4-[2-(3-methoxyphenyl)quinolin-4-yl]sulfanylbutoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 5,7-dimethoxy-3-[4-[2-(3-methoxyphenyl)quinolin-4-yl]sulfanylbutoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 167313415 |
| Molecular Formula | C40H39NO9S |
| Molecular Weight | 709.82 g/mol |
| Exact Mass | 709.23 |
| IUPAC Name | 5,7-dimethoxy-3-[4-[2-(3-methoxyphenyl)quinolin-4-yl]sulfanylbutoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cccc(-c2cc(SCCCCOc3c(-c4cc(OC)c(OC)c(OC)c4)oc4cc(OC)cc(OC)c4c3=O)c3ccccc3n2)c1 |
| InChI | InChI=1S/C40H39NO9S/c1-43-26-13-11-12-24(18-26)30-23-35(28-14-7-8-15-29(28)41-30)51-17-10-9-16-49-40-37(42)36-31(45-3)21-27(44-2)22-32(36)50-38(40)25-19-33(46-4)39(48-6)34(20-25)47-5/h7-8,11-15,18-23H,9-10,16-17H2,1-6H3 |
| InChIKey | XVWSNEHTHLFSDE-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 107.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.82 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|