C34H39FN2O10S — CID 175510192
3-[4-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]butoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 175510192) has the molecular formula C34H39FN2O10S and a molecular weight of 686.76 g/mol. Its IUPAC name is 3-[4-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]butoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 3-[4-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]butoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 175510192 |
| Molecular Formula | C34H39FN2O10S |
| Molecular Weight | 686.76 g/mol |
| Exact Mass | 686.23 |
| IUPAC Name | 3-[4-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]butoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCCN3CCN(S(=O)(=O)c4ccc(F)cc4)CC3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C34H39FN2O10S/c1-41-24-20-26(42-2)30-27(21-24)47-32(22-18-28(43-3)33(45-5)29(19-22)44-4)34(31(30)38)46-17-7-6-12-36-13-15-37(16-14-36)48(39,40)25-10-8-23(35)9-11-25/h8-11,18-21H,6-7,12-17H2,1-5H3 |
| InChIKey | UBFNQEUJNJDHSV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 126.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.76 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|