C34H40N2O10S — CID 175510191
5,7-dimethoxy-3-[3-[3-(4-methylphenyl)sulfonylpiperazin-1-yl]propoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 175510191) has the molecular formula C34H40N2O10S and a molecular weight of 668.77 g/mol. Its IUPAC name is 5,7-dimethoxy-3-[3-[3-(4-methylphenyl)sulfonylpiperazin-1-yl]propoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 5,7-dimethoxy-3-[3-[3-(4-methylphenyl)sulfonylpiperazin-1-yl]propoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 175510191 |
| Molecular Formula | C34H40N2O10S |
| Molecular Weight | 668.77 g/mol |
| Exact Mass | 668.24 |
| IUPAC Name | 5,7-dimethoxy-3-[3-[3-(4-methylphenyl)sulfonylpiperazin-1-yl]propoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCN3CCNC(S(=O)(=O)c4ccc(C)cc4)C3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C34H40N2O10S/c1-21-8-10-24(11-9-21)47(38,39)29-20-36(14-12-35-29)13-7-15-45-34-31(37)30-25(41-3)18-23(40-2)19-26(30)46-32(34)22-16-27(42-4)33(44-6)28(17-22)43-5/h8-11,16-19,29,35H,7,12-15,20H2,1-6H3 |
| InChIKey | IGZOSBXKGXDYKU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 135.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.77 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|