C26H32N2O5 — CID 142378937
2-[3,5-dimethyl-4-(3-piperazin-1-ylpropoxy)phenyl]-5,7-dimethoxychromen-4-one (PubChem CID 142378937) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-(3-piperazin-1-ylpropoxy)phenyl]-5,7-dimethoxychromen-4-one.
| Compound Name | 2-[3,5-dimethyl-4-(3-piperazin-1-ylpropoxy)phenyl]-5,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 142378937 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-[3,5-dimethyl-4-(3-piperazin-1-ylpropoxy)phenyl]-5,7-dimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3cc(C)c(OCCCN4CCNCC4)c(C)c3)oc2c1 |
| InChI | InChI=1S/C26H32N2O5/c1-17-12-19(13-18(2)26(17)32-11-5-8-28-9-6-27-7-10-28)22-16-21(29)25-23(31-4)14-20(30-3)15-24(25)33-22/h12-16,27H,5-11H2,1-4H3 |
| InChIKey | HTYUOGULFXPUGO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|