C27H33NO5 — CID 135144046
2-[3,5-dimethyl-4-(3-piperidin-1-ylpropoxy)phenyl]-5,7-dimethoxychromen-4-one (PubChem CID 135144046) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-(3-piperidin-1-ylpropoxy)phenyl]-5,7-dimethoxychromen-4-one.
| Compound Name | 2-[3,5-dimethyl-4-(3-piperidin-1-ylpropoxy)phenyl]-5,7-dimethoxychromen-4-one |
|---|---|
| PubChem CID | 135144046 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 2-[3,5-dimethyl-4-(3-piperidin-1-ylpropoxy)phenyl]-5,7-dimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3cc(C)c(OCCCN4CCCCC4)c(C)c3)oc2c1 |
| InChI | InChI=1S/C27H33NO5/c1-18-13-20(14-19(2)27(18)32-12-8-11-28-9-6-5-7-10-28)23-17-22(29)26-24(31-4)15-21(30-3)16-25(26)33-23/h13-17H,5-12H2,1-4H3 |
| InChIKey | KZWVYDORAJHBJN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|