C29H37NO5 — CID 127036654
2-(3,4-dimethoxyphenyl)-7-(8-pyrrolidin-1-yloctoxy)chromen-4-one (PubChem CID 127036654) has the molecular formula C29H37NO5 and a molecular weight of 479.62 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-7-(8-pyrrolidin-1-yloctoxy)chromen-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-7-(8-pyrrolidin-1-yloctoxy)chromen-4-one |
|---|---|
| PubChem CID | 127036654 |
| Molecular Formula | C29H37NO5 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-7-(8-pyrrolidin-1-yloctoxy)chromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3ccc(OCCCCCCCCN4CCCC4)cc3o2)cc1OC |
| InChI | InChI=1S/C29H37NO5/c1-32-26-14-11-22(19-29(26)33-2)27-21-25(31)24-13-12-23(20-28(24)35-27)34-18-10-6-4-3-5-7-15-30-16-8-9-17-30/h11-14,19-21H,3-10,15-18H2,1-2H3 |
| InChIKey | KVFWGUPLAOZNQY-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|