C22H23NO4 — CID 118708574
6,7-dimethoxy-2-[4-(pyrrolidin-1-ylmethyl)phenyl]chromen-4-one (PubChem CID 118708574) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[4-(pyrrolidin-1-ylmethyl)phenyl]chromen-4-one.
| Compound Name | 6,7-dimethoxy-2-[4-(pyrrolidin-1-ylmethyl)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 118708574 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 6,7-dimethoxy-2-[4-(pyrrolidin-1-ylmethyl)phenyl]chromen-4-one |
| SMILES | COc1cc2oc(-c3ccc(CN4CCCC4)cc3)cc(=O)c2cc1OC |
| InChI | InChI=1S/C22H23NO4/c1-25-21-11-17-18(24)12-19(27-20(17)13-22(21)26-2)16-7-5-15(6-8-16)14-23-9-3-4-10-23/h5-8,11-13H,3-4,9-10,14H2,1-2H3 |
| InChIKey | SHPCADFURJJOOU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |