C17H14O7 — CID 71436763
6,7-dimethoxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one (PubChem CID 71436763) has the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. Its IUPAC name is 6,7-dimethoxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one.
| Compound Name | 6,7-dimethoxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 71436763 |
| Molecular Formula | C17H14O7 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 6,7-dimethoxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| SMILES | COc1cc2oc(-c3cc(O)c(O)c(O)c3)cc(=O)c2cc1OC |
| InChI | InChI=1S/C17H14O7/c1-22-15-5-9-10(18)6-13(24-14(9)7-16(15)23-2)8-3-11(19)17(21)12(20)4-8/h3-7,19-21H,1-2H3 |
| InChIKey | CTILYKBMKBRHFG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|