C24H20O5 — CID 155754088
6,7-dimethoxy-2-[4-(4-methoxyphenyl)phenyl]chromen-4-one (PubChem CID 155754088) has the molecular formula C24H20O5 and a molecular weight of 388.42 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[4-(4-methoxyphenyl)phenyl]chromen-4-one.
| Compound Name | 6,7-dimethoxy-2-[4-(4-methoxyphenyl)phenyl]chromen-4-one |
|---|---|
| PubChem CID | 155754088 |
| Molecular Formula | C24H20O5 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 6,7-dimethoxy-2-[4-(4-methoxyphenyl)phenyl]chromen-4-one |
| SMILES | COc1ccc(-c2ccc(-c3cc(=O)c4cc(OC)c(OC)cc4o3)cc2)cc1 |
| InChI | InChI=1S/C24H20O5/c1-26-18-10-8-16(9-11-18)15-4-6-17(7-5-15)21-13-20(25)19-12-23(27-2)24(28-3)14-22(19)29-21/h4-14H,1-3H3 |
| InChIKey | ZYFFPGMQUJXMKI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |