C23H15NO4 — CID 101038958
2-(4-methoxyphenyl)-11H-pyrano[3,2-b]acridine-4,6-dione (PubChem CID 101038958) has the molecular formula C23H15NO4 and a molecular weight of 369.38 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-11H-pyrano[3,2-b]acridine-4,6-dione.
| Compound Name | 2-(4-methoxyphenyl)-11H-pyrano[3,2-b]acridine-4,6-dione |
|---|---|
| PubChem CID | 101038958 |
| Molecular Formula | C23H15NO4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 2-(4-methoxyphenyl)-11H-pyrano[3,2-b]acridine-4,6-dione |
| SMILES | COc1ccc(-c2cc(=O)c3cc4c(=O)c5ccccc5[nH]c4cc3o2)cc1 |
| InChI | InChI=1S/C23H15NO4/c1-27-14-8-6-13(7-9-14)21-12-20(25)17-10-16-19(11-22(17)28-21)24-18-5-3-2-4-15(18)23(16)26/h2-12H,1H3,(H,24,26) |
| InChIKey | YCKXLTUBIRCHFK-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|