C17H13FO5 — CID 177477237
6-fluoro-2-(4-hydroxy-3,5-dimethoxyphenyl)chromen-4-one (PubChem CID 177477237) has the molecular formula C17H13FO5 and a molecular weight of 316.28 g/mol. Its IUPAC name is 6-fluoro-2-(4-hydroxy-3,5-dimethoxyphenyl)chromen-4-one.
| Compound Name | 6-fluoro-2-(4-hydroxy-3,5-dimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 177477237 |
| Molecular Formula | C17H13FO5 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 6-fluoro-2-(4-hydroxy-3,5-dimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(-c2cc(=O)c3cc(F)ccc3o2)cc(OC)c1O |
| InChI | InChI=1S/C17H13FO5/c1-21-15-5-9(6-16(22-2)17(15)20)14-8-12(19)11-7-10(18)3-4-13(11)23-14/h3-8,20H,1-2H3 |
| InChIKey | IBYJYXHDWRAQHD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |