C18H15FO6 — CID 66573995
6-fluoro-3-hydroxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 66573995) has the molecular formula C18H15FO6 and a molecular weight of 346.31 g/mol. Its IUPAC name is 6-fluoro-3-hydroxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 6-fluoro-3-hydroxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 66573995 |
| Molecular Formula | C18H15FO6 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 6-fluoro-3-hydroxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(-c2oc3ccc(F)cc3c(=O)c2O)cc(OC)c1OC |
| InChI | InChI=1S/C18H15FO6/c1-22-13-6-9(7-14(23-2)18(13)24-3)17-16(21)15(20)11-8-10(19)4-5-12(11)25-17/h4-8,21H,1-3H3 |
| InChIKey | ZAUOVNJAOIUIRE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |