C29H37N3O4 — CID 134138095
2-[2-[4-(dimethylamino)phenyl]-4-oxochromen-7-yl]oxy-N-(6-pyrrolidin-1-ylhexyl)acetamide (PubChem CID 134138095) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is 2-[2-[4-(dimethylamino)phenyl]-4-oxochromen-7-yl]oxy-N-(6-pyrrolidin-1-ylhexyl)acetamide.
| Compound Name | 2-[2-[4-(dimethylamino)phenyl]-4-oxochromen-7-yl]oxy-N-(6-pyrrolidin-1-ylhexyl)acetamide |
|---|---|
| PubChem CID | 134138095 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 2-[2-[4-(dimethylamino)phenyl]-4-oxochromen-7-yl]oxy-N-(6-pyrrolidin-1-ylhexyl)acetamide |
| SMILES | CN(C)c1ccc(-c2cc(=O)c3ccc(OCC(=O)NCCCCCCN4CCCC4)cc3o2)cc1 |
| InChI | InChI=1S/C29H37N3O4/c1-31(2)23-11-9-22(10-12-23)27-20-26(33)25-14-13-24(19-28(25)36-27)35-21-29(34)30-15-5-3-4-6-16-32-17-7-8-18-32/h9-14,19-20H,3-8,15-18,21H2,1-2H3,(H,30,34) |
| InChIKey | FBSQNPVGAVGJQX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|