C20H19BrO5 — CID 69029207
7-(3-bromopropoxy)-2-(3,4-dimethoxyphenyl)chromen-4-one (PubChem CID 69029207) has the molecular formula C20H19BrO5 and a molecular weight of 419.27 g/mol. Its IUPAC name is 7-(3-bromopropoxy)-2-(3,4-dimethoxyphenyl)chromen-4-one.
| Compound Name | 7-(3-bromopropoxy)-2-(3,4-dimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 69029207 |
| Molecular Formula | C20H19BrO5 |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | 7-(3-bromopropoxy)-2-(3,4-dimethoxyphenyl)chromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3ccc(OCCCBr)cc3o2)cc1OC |
| InChI | InChI=1S/C20H19BrO5/c1-23-17-7-4-13(10-20(17)24-2)18-12-16(22)15-6-5-14(11-19(15)26-18)25-9-3-8-21/h4-7,10-12H,3,8-9H2,1-2H3 |
| InChIKey | QNUPUNUWSCEHAP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|