C23H18O5 — CID 139217483
2-(3-hydroxy-4-methoxyphenyl)-7-phenylmethoxychromen-4-one (PubChem CID 139217483) has the molecular formula C23H18O5 and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-(3-hydroxy-4-methoxyphenyl)-7-phenylmethoxychromen-4-one.
| Compound Name | 2-(3-hydroxy-4-methoxyphenyl)-7-phenylmethoxychromen-4-one |
|---|---|
| PubChem CID | 139217483 |
| Molecular Formula | C23H18O5 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-(3-hydroxy-4-methoxyphenyl)-7-phenylmethoxychromen-4-one |
| SMILES | COc1ccc(-c2cc(=O)c3ccc(OCc4ccccc4)cc3o2)cc1O |
| InChI | InChI=1S/C23H18O5/c1-26-21-10-7-16(11-20(21)25)22-13-19(24)18-9-8-17(12-23(18)28-22)27-14-15-5-3-2-4-6-15/h2-13,25H,14H2,1H3 |
| InChIKey | WEWUNPFBARRTLW-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |