C31H26O6 — CID 178187643
7,8-dimethoxy-5-phenylmethoxy-2-(4-phenylmethoxyphenyl)chromen-4-one (PubChem CID 178187643) has the molecular formula C31H26O6 and a molecular weight of 494.54 g/mol. Its IUPAC name is 7,8-dimethoxy-5-phenylmethoxy-2-(4-phenylmethoxyphenyl)chromen-4-one.
| Compound Name | 7,8-dimethoxy-5-phenylmethoxy-2-(4-phenylmethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 178187643 |
| Molecular Formula | C31H26O6 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 7,8-dimethoxy-5-phenylmethoxy-2-(4-phenylmethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(OCc2ccccc2)c2c(=O)cc(-c3ccc(OCc4ccccc4)cc3)oc2c1OC |
| InChI | InChI=1S/C31H26O6/c1-33-28-18-27(36-20-22-11-7-4-8-12-22)29-25(32)17-26(37-31(29)30(28)34-2)23-13-15-24(16-14-23)35-19-21-9-5-3-6-10-21/h3-18H,19-20H2,1-2H3 |
| InChIKey | YGSQVRXAXLTQAE-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |