C18H15ClO5 — CID 86239579
2-(4-chlorophenyl)-5,7,8-trimethoxychromen-4-one (PubChem CID 86239579) has the molecular formula C18H15ClO5 and a molecular weight of 346.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5,7,8-trimethoxychromen-4-one.
| Compound Name | 2-(4-chlorophenyl)-5,7,8-trimethoxychromen-4-one |
|---|---|
| PubChem CID | 86239579 |
| Molecular Formula | C18H15ClO5 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-(4-chlorophenyl)-5,7,8-trimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3ccc(Cl)cc3)oc2c1OC |
| InChI | InChI=1S/C18H15ClO5/c1-21-14-9-15(22-2)17(23-3)18-16(14)12(20)8-13(24-18)10-4-6-11(19)7-5-10/h4-9H,1-3H3 |
| InChIKey | ZDWRCNSPIQTTRO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |