C21H16O4S — CID 57410655
5,7-dimethoxy-2-phenyl-8-thiophen-3-ylchromen-4-one (PubChem CID 57410655) has the molecular formula C21H16O4S and a molecular weight of 364.42 g/mol. Its IUPAC name is 5,7-dimethoxy-2-phenyl-8-thiophen-3-ylchromen-4-one.
| Compound Name | 5,7-dimethoxy-2-phenyl-8-thiophen-3-ylchromen-4-one |
|---|---|
| PubChem CID | 57410655 |
| Molecular Formula | C21H16O4S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 5,7-dimethoxy-2-phenyl-8-thiophen-3-ylchromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(-c3ccccc3)oc2c1-c1ccsc1 |
| InChI | InChI=1S/C21H16O4S/c1-23-17-11-18(24-2)20-15(22)10-16(13-6-4-3-5-7-13)25-21(20)19(17)14-8-9-26-12-14/h3-12H,1-2H3 |
| InChIKey | FMCLSLMXKJOCEQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |