C18H14O5 — CID 50991857
2-(5-methoxy-4-oxo-2-phenylchromen-8-yl)acetic acid (PubChem CID 50991857) has the molecular formula C18H14O5 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-(5-methoxy-4-oxo-2-phenylchromen-8-yl)acetic acid.
| Compound Name | 2-(5-methoxy-4-oxo-2-phenylchromen-8-yl)acetic acid |
|---|---|
| PubChem CID | 50991857 |
| Molecular Formula | C18H14O5 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-(5-methoxy-4-oxo-2-phenylchromen-8-yl)acetic acid |
| SMILES | COc1ccc(CC(=O)O)c2oc(-c3ccccc3)cc(=O)c12 |
| InChI | InChI=1S/C18H14O5/c1-22-14-8-7-12(9-16(20)21)18-17(14)13(19)10-15(23-18)11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,20,21) |
| InChIKey | WIQKBWDVTDADOJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |