C16H11O5- — CID 86289529
7-hydroxy-8-methoxy-4-oxo-2-phenylchromen-5-olate (PubChem CID 86289529) has the molecular formula C16H11O5- and a molecular weight of 283.26 g/mol. Its IUPAC name is 7-hydroxy-8-methoxy-4-oxo-2-phenylchromen-5-olate.
| Compound Name | 7-hydroxy-8-methoxy-4-oxo-2-phenylchromen-5-olate |
|---|---|
| PubChem CID | 86289529 |
| Molecular Formula | C16H11O5- |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 7-hydroxy-8-methoxy-4-oxo-2-phenylchromen-5-olate |
| SMILES | COc1c(O)cc([O-])c2c(=O)cc(-c3ccccc3)oc12 |
| InChI | InChI=1S/C16H12O5/c1-20-15-12(19)7-10(17)14-11(18)8-13(21-16(14)15)9-5-3-2-4-6-9/h2-8,17,19H,1H3/p-1 |
| InChIKey | XLTFNNCXVBYBSX-UHFFFAOYSA-M |
| XLogP | 2.25 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |