C21H22O6 — CID 164597629
5,7-dihydroxy-2-[4-(5-hydroxypentyl)phenyl]-8-methoxychromen-4-one (PubChem CID 164597629) has the molecular formula C21H22O6 and a molecular weight of 370.40 g/mol. Its IUPAC name is 5,7-dihydroxy-2-[4-(5-hydroxypentyl)phenyl]-8-methoxychromen-4-one.
| Compound Name | 5,7-dihydroxy-2-[4-(5-hydroxypentyl)phenyl]-8-methoxychromen-4-one |
|---|---|
| PubChem CID | 164597629 |
| Molecular Formula | C21H22O6 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 5,7-dihydroxy-2-[4-(5-hydroxypentyl)phenyl]-8-methoxychromen-4-one |
| SMILES | COc1c(O)cc(O)c2c(=O)cc(-c3ccc(CCCCCO)cc3)oc12 |
| InChI | InChI=1S/C21H22O6/c1-26-20-17(25)11-15(23)19-16(24)12-18(27-21(19)20)14-8-6-13(7-9-14)5-3-2-4-10-22/h6-9,11-12,22-23,25H,2-5,10H2,1H3 |
| InChIKey | PLWKFUGBWHONKX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|