About 2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one
2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one (PubChem CID 67234546) has the molecular formula C29H34O7
and a molecular weight of 494.58 g/mol. Its IUPAC name is 2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one.
Molecular Properties
| Compound Name | 2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one |
| PubChem CID | 67234546 |
| Molecular Formula | C29H34O7 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one |
| SMILES | COc1cc(-c2cc(=O)c3c(cc(OC)c4cc(CCCCCCCCCCO)oc43)o2)ccc1O |
| InChI | InChI=1S/C29H34O7/c1-33-25-18-27-28(23(32)17-24(36-27)19-12-13-22(31)26(15-19)34-2)29-21(25)16-20(35-29)11-9-7-5-3-4-6-8-10-14-30/h12-13,15-18,30-31H,3-11,14H2,1-2H3 |
| InChIKey | NGNIVXXNELNMGC-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 102.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one?
The IUPAC name of 2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one (CID 67234546) is 2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one.
What is the SMILES notation for 2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one?
The canonical SMILES for 2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one is COc1cc(-c2cc(=O)c3c(cc(OC)c4cc(CCCCCCCCCCO)oc43)o2)ccc1O.
What is the InChIKey of 2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one?
The InChIKey is NGNIVXXNELNMGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H34O7/c1-33-25-18-27-28(23(32)17-24(36-27)19-12-13-22(31)26(15-19)34-2)29-21(25)16-20(35-29)11-9-7-5-3-4-6-8-10-14-30/h12-13,15-18,30-31H,3-11,14H2,1-2H3.
What are the key properties of 2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one?
2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one has a molecular weight of 494.58 g/mol, XLogP of 6.58, 13 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(10-hydroxydecyl)-7-(4-hydroxy-3-methoxyphenyl)-4-methoxyfuro[2,3-f]chromen-9-one is sourced from PubChem (CID 67234546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).