C21H20O8 — CID 12679339
[2-(3,4-dimethoxyphenyl)-6,7-dimethoxy-4-oxochromen-5-yl] acetate (PubChem CID 12679339) has the molecular formula C21H20O8 and a molecular weight of 400.38 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-6,7-dimethoxy-4-oxochromen-5-yl] acetate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-6,7-dimethoxy-4-oxochromen-5-yl] acetate |
|---|---|
| PubChem CID | 12679339 |
| Molecular Formula | C21H20O8 |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-6,7-dimethoxy-4-oxochromen-5-yl] acetate |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC(C)=O)c(OC)c(OC)cc3o2)cc1OC |
| InChI | InChI=1S/C21H20O8/c1-11(22)28-21-19-13(23)9-15(12-6-7-14(24-2)16(8-12)25-3)29-17(19)10-18(26-4)20(21)27-5/h6-10H,1-5H3 |
| InChIKey | ONUXWYQXLLRJIT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|