C21H20O9 — CID 124519226
[4-(5-hydroxy-3,6,7-trimethoxy-4-oxochromen-2-yl)-2-methoxyphenyl] acetate (PubChem CID 124519226) has the molecular formula C21H20O9 and a molecular weight of 416.38 g/mol. Its IUPAC name is [4-(5-hydroxy-3,6,7-trimethoxy-4-oxochromen-2-yl)-2-methoxyphenyl] acetate.
| Compound Name | [4-(5-hydroxy-3,6,7-trimethoxy-4-oxochromen-2-yl)-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 124519226 |
| Molecular Formula | C21H20O9 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | [4-(5-hydroxy-3,6,7-trimethoxy-4-oxochromen-2-yl)-2-methoxyphenyl] acetate |
| SMILES | COc1cc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2OC)ccc1OC(C)=O |
| InChI | InChI=1S/C21H20O9/c1-10(22)29-12-7-6-11(8-13(12)25-2)19-21(28-5)18(24)16-14(30-19)9-15(26-3)20(27-4)17(16)23/h6-9,23H,1-5H3 |
| InChIKey | BYGJSJNUAJMGQI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 113.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|