C21H22BrNO8 — CID 70553165
[4-(5-hydroxy-3,7-dimethoxy-4-oxochromen-2-yl)-2-methoxyphenyl] (2S)-2-aminopropanoate;hydrobromide (PubChem CID 70553165) has the molecular formula C21H22BrNO8 and a molecular weight of 496.31 g/mol. Its IUPAC name is [4-(5-hydroxy-3,7-dimethoxy-4-oxochromen-2-yl)-2-methoxyphenyl] (2S)-2-aminopropanoate;hydrobromide.
| Compound Name | [4-(5-hydroxy-3,7-dimethoxy-4-oxochromen-2-yl)-2-methoxyphenyl] (2S)-2-aminopropanoate;hydrobromide |
|---|---|
| PubChem CID | 70553165 |
| Molecular Formula | C21H22BrNO8 |
| Molecular Weight | 496.31 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | [4-(5-hydroxy-3,7-dimethoxy-4-oxochromen-2-yl)-2-methoxyphenyl] (2S)-2-aminopropanoate;hydrobromide |
| SMILES | Br.COc1cc(O)c2c(=O)c(OC)c(-c3ccc(OC(=O)[C@H](C)N)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C21H21NO8.BrH/c1-10(22)21(25)30-14-6-5-11(7-15(14)27-3)19-20(28-4)18(24)17-13(23)8-12(26-2)9-16(17)29-19;/h5-10,23H,22H2,1-4H3;1H/t10-;/m0./s1 |
| InChIKey | CHRZOLRFDWULPE-PPHPATTJSA-N |
| XLogP | 3.02 |
| TPSA | 130.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|