C22H20N2O11 — CID 142727084
(2S)-2-[[3-[(2S)-2-aminopropanoyl]oxy-2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxycarbonylamino]propanoic acid (PubChem CID 142727084) has the molecular formula C22H20N2O11 and a molecular weight of 488.41 g/mol. Its IUPAC name is (2S)-2-[[3-[(2S)-2-aminopropanoyl]oxy-2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-2-[[3-[(2S)-2-aminopropanoyl]oxy-2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 142727084 |
| Molecular Formula | C22H20N2O11 |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | (2S)-2-[[3-[(2S)-2-aminopropanoyl]oxy-2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxycarbonylamino]propanoic acid |
| SMILES | C[C@H](N)C(=O)Oc1c(-c2ccc(O)c(O)c2)oc2cc(OC(=O)N[C@@H](C)C(=O)O)cc(O)c2c1=O |
| InChI | InChI=1S/C22H20N2O11/c1-8(23)21(31)35-19-17(28)16-14(27)6-11(33-22(32)24-9(2)20(29)30)7-15(16)34-18(19)10-3-4-12(25)13(26)5-10/h3-9,25-27H,23H2,1-2H3,(H,24,32)(H,29,30)/t8-,9-/m0/s1 |
| InChIKey | CZXZYWUIRCCOLT-IUCAKERBSA-N |
| XLogP | 1.39 |
| TPSA | 218.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|