C18H16O7 — CID 91669171
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-propoxychromen-4-one (PubChem CID 91669171) has the molecular formula C18H16O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-propoxychromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-propoxychromen-4-one |
|---|---|
| PubChem CID | 91669171 |
| Molecular Formula | C18H16O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-propoxychromen-4-one |
| SMILES | CCCOc1c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c2c1=O |
| InChI | InChI=1S/C18H16O7/c1-2-5-24-18-16(23)15-13(22)7-10(19)8-14(15)25-17(18)9-3-4-11(20)12(21)6-9/h3-4,6-8,19-22H,2,5H2,1H3 |
| InChIKey | MEZFHISVIISPBT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|