C21H20F2O5 — CID 177252141
2-(3,4-difluorophenyl)-3-(3,3-dimethylbutoxy)-5,7-dihydroxychromen-4-one (PubChem CID 177252141) has the molecular formula C21H20F2O5 and a molecular weight of 390.38 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-3-(3,3-dimethylbutoxy)-5,7-dihydroxychromen-4-one.
| Compound Name | 2-(3,4-difluorophenyl)-3-(3,3-dimethylbutoxy)-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 177252141 |
| Molecular Formula | C21H20F2O5 |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-(3,4-difluorophenyl)-3-(3,3-dimethylbutoxy)-5,7-dihydroxychromen-4-one |
| SMILES | CC(C)(C)CCOc1c(-c2ccc(F)c(F)c2)oc2cc(O)cc(O)c2c1=O |
| InChI | InChI=1S/C21H20F2O5/c1-21(2,3)6-7-27-20-18(26)17-15(25)9-12(24)10-16(17)28-19(20)11-4-5-13(22)14(23)8-11/h4-5,8-10,24-25H,6-7H2,1-3H3 |
| InChIKey | SSTCOIUKHDZMOO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |