About 2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one
2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one (PubChem CID 177252125) has the molecular formula C22H21F2NO5
and a molecular weight of 417.41 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one.
Molecular Properties
| Compound Name | 2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one |
| PubChem CID | 177252125 |
| Molecular Formula | C22H21F2NO5 |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one |
| SMILES | O=c1c(OCCN2CCCCC2)c(-c2ccc(F)c(F)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C22H21F2NO5/c23-15-5-4-13(10-16(15)24)21-22(29-9-8-25-6-2-1-3-7-25)20(28)19-17(27)11-14(26)12-18(19)30-21/h4-5,10-12,26-27H,1-3,6-9H2 |
| InChIKey | DTDRGSUKTNVGMH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one?
The IUPAC name of 2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one (CID 177252125) is 2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one.
What is the SMILES notation for 2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one?
The canonical SMILES for 2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one is O=c1c(OCCN2CCCCC2)c(-c2ccc(F)c(F)c2)oc2cc(O)cc(O)c12.
What is the InChIKey of 2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one?
The InChIKey is DTDRGSUKTNVGMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21F2NO5/c23-15-5-4-13(10-16(15)24)21-22(29-9-8-25-6-2-1-3-7-25)20(28)19-17(27)11-14(26)12-18(19)30-21/h4-5,10-12,26-27H,1-3,6-9H2.
What are the key properties of 2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one?
2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one has a molecular weight of 417.41 g/mol, XLogP of 4.01, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-difluorophenyl)-5,7-dihydroxy-3-(2-piperidin-1-ylethoxy)chromen-4-one is sourced from PubChem (CID 177252125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).