C19H18O7 — CID 118711941
3-butoxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one (PubChem CID 118711941) has the molecular formula C19H18O7 and a molecular weight of 358.35 g/mol. Its IUPAC name is 3-butoxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one.
| Compound Name | 3-butoxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 118711941 |
| Molecular Formula | C19H18O7 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 3-butoxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| SMILES | CCCCOc1c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c2c1=O |
| InChI | InChI=1S/C19H18O7/c1-2-3-6-25-19-17(24)16-14(23)8-11(20)9-15(16)26-18(19)10-4-5-12(21)13(22)7-10/h4-5,7-9,20-23H,2-3,6H2,1H3 |
| InChIKey | WIIYQYWAPDCDNA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|