C22H24ClNO9 — CID 122182136
5-hydroxy-3-methoxy-7-(2-morpholin-4-ylethoxy)-2-(3,4,5-trihydroxyphenyl)chromen-4-one;hydrochloride (PubChem CID 122182136) has the molecular formula C22H24ClNO9 and a molecular weight of 481.89 g/mol. Its IUPAC name is 5-hydroxy-3-methoxy-7-(2-morpholin-4-ylethoxy)-2-(3,4,5-trihydroxyphenyl)chromen-4-one;hydrochloride.
| Compound Name | 5-hydroxy-3-methoxy-7-(2-morpholin-4-ylethoxy)-2-(3,4,5-trihydroxyphenyl)chromen-4-one;hydrochloride |
|---|---|
| PubChem CID | 122182136 |
| Molecular Formula | C22H24ClNO9 |
| Molecular Weight | 481.89 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 5-hydroxy-3-methoxy-7-(2-morpholin-4-ylethoxy)-2-(3,4,5-trihydroxyphenyl)chromen-4-one;hydrochloride |
| SMILES | COc1c(-c2cc(O)c(O)c(O)c2)oc2cc(OCCN3CCOCC3)cc(O)c2c1=O.Cl |
| InChI | InChI=1S/C22H23NO9.ClH/c1-29-22-20(28)18-14(24)10-13(31-7-4-23-2-5-30-6-3-23)11-17(18)32-21(22)12-8-15(25)19(27)16(26)9-12;/h8-11,24-27H,2-7H2,1H3;1H |
| InChIKey | CYOMJTCQWMJJKU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 142.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.89 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|