C23H24O13 — CID 162816986
2-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-3-methoxy-7-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]chromen-4-one (PubChem CID 162816986) has the molecular formula C23H24O13 and a molecular weight of 508.43 g/mol. Its IUPAC name is 2-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-3-methoxy-7-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]chromen-4-one.
| Compound Name | 2-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-3-methoxy-7-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]chromen-4-one |
|---|---|
| PubChem CID | 162816986 |
| Molecular Formula | C23H24O13 |
| Molecular Weight | 508.43 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | 2-(3,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-3-methoxy-7-[(3,4,5,6-tetrahydroxyoxan-2-yl)methoxy]chromen-4-one |
| SMILES | COc1cc(-c2oc3cc(OCC4OC(O)C(O)C(O)C4O)cc(O)c3c(=O)c2OC)cc(O)c1O |
| InChI | InChI=1S/C23H24O13/c1-32-13-4-8(3-11(25)16(13)26)21-22(33-2)18(28)15-10(24)5-9(6-12(15)35-21)34-7-14-17(27)19(29)20(30)23(31)36-14/h3-6,14,17,19-20,23-27,29-31H,7H2,1-2H3 |
| InChIKey | FKEXRGAGSYDVCS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 208.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.43 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|