C22H22ClNO3 — CID 39773615
2-(4-chlorophenyl)-3-(2-piperidin-1-ylethoxy)chromen-4-one (PubChem CID 39773615) has the molecular formula C22H22ClNO3 and a molecular weight of 383.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-(2-piperidin-1-ylethoxy)chromen-4-one.
| Compound Name | 2-(4-chlorophenyl)-3-(2-piperidin-1-ylethoxy)chromen-4-one |
|---|---|
| PubChem CID | 39773615 |
| Molecular Formula | C22H22ClNO3 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-(4-chlorophenyl)-3-(2-piperidin-1-ylethoxy)chromen-4-one |
| SMILES | O=c1c(OCCN2CCCCC2)c(-c2ccc(Cl)cc2)oc2ccccc12 |
| InChI | InChI=1S/C22H22ClNO3/c23-17-10-8-16(9-11-17)21-22(26-15-14-24-12-4-1-5-13-24)20(25)18-6-2-3-7-19(18)27-21/h2-3,6-11H,1,4-5,12-15H2 |
| InChIKey | RXWXSRAYUSYMTO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |