C22H21Cl2NO4 — CID 21001713
6,8-dichloro-2-(4-methylphenyl)-3-(2-morpholin-4-ylethoxy)chromen-4-one (PubChem CID 21001713) has the molecular formula C22H21Cl2NO4 and a molecular weight of 434.32 g/mol. Its IUPAC name is 6,8-dichloro-2-(4-methylphenyl)-3-(2-morpholin-4-ylethoxy)chromen-4-one.
| Compound Name | 6,8-dichloro-2-(4-methylphenyl)-3-(2-morpholin-4-ylethoxy)chromen-4-one |
|---|---|
| PubChem CID | 21001713 |
| Molecular Formula | C22H21Cl2NO4 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 6,8-dichloro-2-(4-methylphenyl)-3-(2-morpholin-4-ylethoxy)chromen-4-one |
| SMILES | Cc1ccc(-c2oc3c(Cl)cc(Cl)cc3c(=O)c2OCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C22H21Cl2NO4/c1-14-2-4-15(5-3-14)20-22(28-11-8-25-6-9-27-10-7-25)19(26)17-12-16(23)13-18(24)21(17)29-20/h2-5,12-13H,6-11H2,1H3 |
| InChIKey | ATPYAVDZDTXZDB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |