C24H15Cl2NO6 — CID 21001730
6,8-dichloro-2-(4-methylphenyl)-3-[2-(3-nitrophenyl)-2-oxoethoxy]chromen-4-one (PubChem CID 21001730) has the molecular formula C24H15Cl2NO6 and a molecular weight of 484.29 g/mol. Its IUPAC name is 6,8-dichloro-2-(4-methylphenyl)-3-[2-(3-nitrophenyl)-2-oxoethoxy]chromen-4-one.
| Compound Name | 6,8-dichloro-2-(4-methylphenyl)-3-[2-(3-nitrophenyl)-2-oxoethoxy]chromen-4-one |
|---|---|
| PubChem CID | 21001730 |
| Molecular Formula | C24H15Cl2NO6 |
| Molecular Weight | 484.29 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 6,8-dichloro-2-(4-methylphenyl)-3-[2-(3-nitrophenyl)-2-oxoethoxy]chromen-4-one |
| SMILES | Cc1ccc(-c2oc3c(Cl)cc(Cl)cc3c(=O)c2OCC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H15Cl2NO6/c1-13-5-7-14(8-6-13)22-24(21(29)18-10-16(25)11-19(26)23(18)33-22)32-12-20(28)15-3-2-4-17(9-15)27(30)31/h2-11H,12H2,1H3 |
| InChIKey | XGGYZVREQCZXDS-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.29 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|