C25H18Cl2O5 — CID 21001647
ethyl 4-[(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxymethyl]benzoate (PubChem CID 21001647) has the molecular formula C25H18Cl2O5 and a molecular weight of 469.32 g/mol. Its IUPAC name is ethyl 4-[(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxymethyl]benzoate.
| Compound Name | ethyl 4-[(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxymethyl]benzoate |
|---|---|
| PubChem CID | 21001647 |
| Molecular Formula | C25H18Cl2O5 |
| Molecular Weight | 469.32 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | ethyl 4-[(6,8-dichloro-4-oxo-2-phenylchromen-3-yl)oxymethyl]benzoate |
| SMILES | CCOC(=O)c1ccc(COc2c(-c3ccccc3)oc3c(Cl)cc(Cl)cc3c2=O)cc1 |
| InChI | InChI=1S/C25H18Cl2O5/c1-2-30-25(29)17-10-8-15(9-11-17)14-31-24-21(28)19-12-18(26)13-20(27)23(19)32-22(24)16-6-4-3-5-7-16/h3-13H,2,14H2,1H3 |
| InChIKey | ASQPKYJONZIFJI-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.32 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |