C29H27ClO5 — CID 21001172
methyl 4-[[2-(4-tert-butylphenyl)-6-chloro-7-methyl-4-oxochromen-3-yl]oxymethyl]benzoate (PubChem CID 21001172) has the molecular formula C29H27ClO5 and a molecular weight of 490.98 g/mol. Its IUPAC name is methyl 4-[[2-(4-tert-butylphenyl)-6-chloro-7-methyl-4-oxochromen-3-yl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[2-(4-tert-butylphenyl)-6-chloro-7-methyl-4-oxochromen-3-yl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 21001172 |
| Molecular Formula | C29H27ClO5 |
| Molecular Weight | 490.98 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | methyl 4-[[2-(4-tert-butylphenyl)-6-chloro-7-methyl-4-oxochromen-3-yl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2c(-c3ccc(C(C)(C)C)cc3)oc3cc(C)c(Cl)cc3c2=O)cc1 |
| InChI | InChI=1S/C29H27ClO5/c1-17-14-24-22(15-23(17)30)25(31)27(34-16-18-6-8-20(9-7-18)28(32)33-5)26(35-24)19-10-12-21(13-11-19)29(2,3)4/h6-15H,16H2,1-5H3 |
| InChIKey | HTMGBWKXTXNFFI-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.98 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |