C26H28ClNO5 — CID 21001140
2-(4-tert-butylphenyl)-6-chloro-7-methyl-3-(2-morpholin-4-yl-2-oxoethoxy)chromen-4-one (PubChem CID 21001140) has the molecular formula C26H28ClNO5 and a molecular weight of 469.97 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-6-chloro-7-methyl-3-(2-morpholin-4-yl-2-oxoethoxy)chromen-4-one.
| Compound Name | 2-(4-tert-butylphenyl)-6-chloro-7-methyl-3-(2-morpholin-4-yl-2-oxoethoxy)chromen-4-one |
|---|---|
| PubChem CID | 21001140 |
| Molecular Formula | C26H28ClNO5 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 2-(4-tert-butylphenyl)-6-chloro-7-methyl-3-(2-morpholin-4-yl-2-oxoethoxy)chromen-4-one |
| SMILES | Cc1cc2oc(-c3ccc(C(C)(C)C)cc3)c(OCC(=O)N3CCOCC3)c(=O)c2cc1Cl |
| InChI | InChI=1S/C26H28ClNO5/c1-16-13-21-19(14-20(16)27)23(30)25(32-15-22(29)28-9-11-31-12-10-28)24(33-21)17-5-7-18(8-6-17)26(2,3)4/h5-8,13-14H,9-12,15H2,1-4H3 |
| InChIKey | OVLRPQQTECOTRJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |