C22H21ClO5 — CID 7747648
ethyl (2S)-2-[6-chloro-7-methyl-2-(4-methylphenyl)-4-oxochromen-3-yl]oxypropanoate (PubChem CID 7747648) has the molecular formula C22H21ClO5 and a molecular weight of 400.86 g/mol. Its IUPAC name is ethyl (2S)-2-[6-chloro-7-methyl-2-(4-methylphenyl)-4-oxochromen-3-yl]oxypropanoate.
| Compound Name | ethyl (2S)-2-[6-chloro-7-methyl-2-(4-methylphenyl)-4-oxochromen-3-yl]oxypropanoate |
|---|---|
| PubChem CID | 7747648 |
| Molecular Formula | C22H21ClO5 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | ethyl (2S)-2-[6-chloro-7-methyl-2-(4-methylphenyl)-4-oxochromen-3-yl]oxypropanoate |
| SMILES | CCOC(=O)[C@H](C)Oc1c(-c2ccc(C)cc2)oc2cc(C)c(Cl)cc2c1=O |
| InChI | InChI=1S/C22H21ClO5/c1-5-26-22(25)14(4)27-21-19(24)16-11-17(23)13(3)10-18(16)28-20(21)15-8-6-12(2)7-9-15/h6-11,14H,5H2,1-4H3/t14-/m0/s1 |
| InChIKey | YQZUIEYTJYYDLO-AWEZNQCLSA-N |
| XLogP | 5.06 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |