C21H19ClO5 — CID 4112757
ethyl 2-[2-(4-chlorophenyl)-7-methyl-4-oxochromen-3-yl]oxypropanoate (PubChem CID 4112757) has the molecular formula C21H19ClO5 and a molecular weight of 386.83 g/mol. Its IUPAC name is ethyl 2-[2-(4-chlorophenyl)-7-methyl-4-oxochromen-3-yl]oxypropanoate.
| Compound Name | ethyl 2-[2-(4-chlorophenyl)-7-methyl-4-oxochromen-3-yl]oxypropanoate |
|---|---|
| PubChem CID | 4112757 |
| Molecular Formula | C21H19ClO5 |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | ethyl 2-[2-(4-chlorophenyl)-7-methyl-4-oxochromen-3-yl]oxypropanoate |
| SMILES | CCOC(=O)C(C)Oc1c(-c2ccc(Cl)cc2)oc2cc(C)ccc2c1=O |
| InChI | InChI=1S/C21H19ClO5/c1-4-25-21(24)13(3)26-20-18(23)16-10-5-12(2)11-17(16)27-19(20)14-6-8-15(22)9-7-14/h5-11,13H,4H2,1-3H3 |
| InChIKey | NCCCQDYPEFRPBX-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |