C29H25ClO4 — CID 4088706
[2-(4-tert-butylphenyl)-7-methyl-4-oxochromen-3-yl] 3-(4-chlorophenyl)prop-2-enoate (PubChem CID 4088706) has the molecular formula C29H25ClO4 and a molecular weight of 472.97 g/mol. Its IUPAC name is [2-(4-tert-butylphenyl)-7-methyl-4-oxochromen-3-yl] 3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-(4-tert-butylphenyl)-7-methyl-4-oxochromen-3-yl] 3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4088706 |
| Molecular Formula | C29H25ClO4 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [2-(4-tert-butylphenyl)-7-methyl-4-oxochromen-3-yl] 3-(4-chlorophenyl)prop-2-enoate |
| SMILES | Cc1ccc2c(=O)c(OC(=O)C=Cc3ccc(Cl)cc3)c(-c3ccc(C(C)(C)C)cc3)oc2c1 |
| InChI | InChI=1S/C29H25ClO4/c1-18-5-15-23-24(17-18)33-27(20-9-11-21(12-10-20)29(2,3)4)28(26(23)32)34-25(31)16-8-19-6-13-22(30)14-7-19/h5-17H,1-4H3 |
| InChIKey | SBFJKZNUFHPTHL-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|