C27H21ClO6 — CID 4130618
[2-(4-chlorophenyl)-6-methyl-4-oxochromen-3-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 4130618) has the molecular formula C27H21ClO6 and a molecular weight of 476.91 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-6-methyl-4-oxochromen-3-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(4-chlorophenyl)-6-methyl-4-oxochromen-3-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 4130618 |
| Molecular Formula | C27H21ClO6 |
| Molecular Weight | 476.91 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | [2-(4-chlorophenyl)-6-methyl-4-oxochromen-3-yl] 3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=CC(=O)Oc2c(-c3ccc(Cl)cc3)oc3ccc(C)cc3c2=O)cc1OC |
| InChI | InChI=1S/C27H21ClO6/c1-16-4-11-21-20(14-16)25(30)27(26(33-21)18-7-9-19(28)10-8-18)34-24(29)13-6-17-5-12-22(31-2)23(15-17)32-3/h4-15H,1-3H3 |
| InChIKey | PYJXAKTUKQTALH-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.91 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|