C27H20ClNO8 — CID 21001602
[6-chloro-2-(3,4-dimethoxyphenyl)-7-methyl-4-oxochromen-3-yl] (Z)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 21001602) has the molecular formula C27H20ClNO8 and a molecular weight of 521.91 g/mol. Its IUPAC name is [6-chloro-2-(3,4-dimethoxyphenyl)-7-methyl-4-oxochromen-3-yl] (Z)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [6-chloro-2-(3,4-dimethoxyphenyl)-7-methyl-4-oxochromen-3-yl] (Z)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 21001602 |
| Molecular Formula | C27H20ClNO8 |
| Molecular Weight | 521.91 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | [6-chloro-2-(3,4-dimethoxyphenyl)-7-methyl-4-oxochromen-3-yl] (Z)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | COc1ccc(-c2oc3cc(C)c(Cl)cc3c(=O)c2OC(=O)/C=C\c2cccc([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C27H20ClNO8/c1-15-11-22-19(14-20(15)28)25(31)27(26(36-22)17-8-9-21(34-2)23(13-17)35-3)37-24(30)10-7-16-5-4-6-18(12-16)29(32)33/h4-14H,1-3H3/b10-7- |
| InChIKey | IPSHNKXSORIBLB-YFHOEESVSA-N |
| XLogP | 5.97 |
| TPSA | 118.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.91 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|